C28H24ClF3N4O6S — CID 87279788
4-[4-[N-carbamoyl-4-chloro-3-(trifluoromethyl)anilino]phenoxy]-N-methylpyridine-2-carboxamide;4-methylbenzenesulfonic acid (PubChem CID 87279788) has the molecular formula C28H24ClF3N4O6S and a molecular weight of 637.04 g/mol. Its IUPAC name is 4-[4-[N-carbamoyl-4-chloro-3-(trifluoromethyl)anilino]phenoxy]-N-methylpyridine-2-carboxamide;4-methylbenzenesulfonic acid.
| Compound Name | 4-[4-[N-carbamoyl-4-chloro-3-(trifluoromethyl)anilino]phenoxy]-N-methylpyridine-2-carboxamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87279788 |
| Molecular Formula | C28H24ClF3N4O6S |
| Molecular Weight | 637.04 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | 4-[4-[N-carbamoyl-4-chloro-3-(trifluoromethyl)anilino]phenoxy]-N-methylpyridine-2-carboxamide;4-methylbenzenesulfonic acid |
| SMILES | CNC(=O)c1cc(Oc2ccc(N(C(N)=O)c3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H16ClF3N4O3.C7H8O3S/c1-27-19(30)18-11-15(8-9-28-18)32-14-5-2-12(3-6-14)29(20(26)31)13-4-7-17(22)16(10-13)21(23,24)25;1-6-2-4-7(5-3-6)11(8,9)10/h2-11H,1H3,(H2,26,31)(H,27,30);2-5H,1H3,(H,8,9,10) |
| InChIKey | YUHGRWLYPLKQKQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.04 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|