C34H50F3NO3 — CID 87282643
(4aS,6aR,6aS,6bR,12aS,14bS)-N-cyclopropyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-N-(trifluoromethyl)-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide (PubChem CID 87282643) has the molecular formula C34H50F3NO3 and a molecular weight of 577.77 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,12aS,14bS)-N-cyclopropyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-N-(trifluoromethyl)-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide.
| Compound Name | (4aS,6aR,6aS,6bR,12aS,14bS)-N-cyclopropyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-N-(trifluoromethyl)-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 87282643 |
| Molecular Formula | C34H50F3NO3 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.37 |
| IUPAC Name | (4aS,6aR,6aS,6bR,12aS,14bS)-N-cyclopropyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-N-(trifluoromethyl)-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C(=O)N(OC2CC2)C(F)(F)F)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CCCC(C)(C)C5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C34H50F3NO3/c1-28(2)12-8-13-31(5)25(28)11-14-33(7)26(31)24(39)19-22-23-20-30(4,16-15-29(23,3)17-18-32(22,33)6)27(40)38(34(35,36)37)41-21-9-10-21/h19,21,23,25-26H,8-18,20H2,1-7H3/t23-,25?,26-,29-,30?,31+,32-,33-/m1/s1 |
| InChIKey | CQVGWUUMDBBBJI-BPDFRGAXSA-N |
| XLogP | 8.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|