C25H30NO2P — CID 87282982
5-[dimethylamino(triphenyl)-λ5-phosphanyl]pentanoic acid (PubChem CID 87282982) has the molecular formula C25H30NO2P and a molecular weight of 407.49 g/mol. Its IUPAC name is 5-[dimethylamino(triphenyl)-λ5-phosphanyl]pentanoic acid.
| Compound Name | 5-[dimethylamino(triphenyl)-λ5-phosphanyl]pentanoic acid |
|---|---|
| PubChem CID | 87282982 |
| Molecular Formula | C25H30NO2P |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-[dimethylamino(triphenyl)-λ5-phosphanyl]pentanoic acid |
| SMILES | CN(C)P(CCCCC(=O)O)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30NO2P/c1-26(2)29(21-13-12-20-25(27)28,22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19H,12-13,20-21H2,1-2H3,(H,27,28) |
| InChIKey | XRJBKPWRWGKHTL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|