C27H37BrN4O4 — CID 87284412
2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetohydrazide;hydrobromide (PubChem CID 87284412) has the molecular formula C27H37BrN4O4 and a molecular weight of 561.52 g/mol. Its IUPAC name is 2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetohydrazide;hydrobromide.
| Compound Name | 2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetohydrazide;hydrobromide |
|---|---|
| PubChem CID | 87284412 |
| Molecular Formula | C27H37BrN4O4 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetohydrazide;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(C(OC)C(=O)NN)ccc2CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36N4O4.BrH/c1-26(2,3)19-11-17(12-20(22(19)33)27(4,5)6)21(32)14-31-13-16-9-8-15(10-18(16)24(31)28)23(35-7)25(34)30-29;/h8-12,23,28,33H,13-14,29H2,1-7H3,(H,30,34);1H/b28-24-; |
| InChIKey | VKESKFLJRCFXFK-QQBZCDAESA-N |
| XLogP | 4.27 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|