C29H33F3N2O6 — CID 87284455
[2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetyl] 2,2,2-trifluoroacetate (PubChem CID 87284455) has the molecular formula C29H33F3N2O6 and a molecular weight of 562.59 g/mol. Its IUPAC name is [2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87284455 |
| Molecular Formula | C29H33F3N2O6 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | [2-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-3-imino-1H-isoindol-5-yl]-2-methoxyacetyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C1/c2cc(C(OC)C(=O)OC(=O)C(F)(F)F)ccc2CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H33F3N2O6/c1-27(2,3)19-11-17(12-20(22(19)36)28(4,5)6)21(35)14-34-13-16-9-8-15(10-18(16)24(34)33)23(39-7)25(37)40-26(38)29(30,31)32/h8-12,23,33,36H,13-14H2,1-7H3/b33-24- |
| InChIKey | VQAIBTRHNFLOIZ-GIBOGKFOSA-N |
| XLogP | 5.33 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|