C18H14Cl2F6N4O2 — CID 87286939
methyl 2-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(E)-dimethylaminomethylideneamino]-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 87286939) has the molecular formula C18H14Cl2F6N4O2 and a molecular weight of 503.23 g/mol. Its IUPAC name is methyl 2-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(E)-dimethylaminomethylideneamino]-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | methyl 2-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(E)-dimethylaminomethylideneamino]-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 87286939 |
| Molecular Formula | C18H14Cl2F6N4O2 |
| Molecular Weight | 503.23 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | methyl 2-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(E)-dimethylaminomethylideneamino]-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1c(C(F)(F)F)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1/N=C/N(C)C |
| InChI | InChI=1S/C18H14Cl2F6N4O2/c1-8(16(31)32-4)12-14(18(24,25)26)28-30(15(12)27-7-29(2)3)13-10(19)5-9(6-11(13)20)17(21,22)23/h5-7H,1H2,2-4H3/b27-7+ |
| InChIKey | DREHSLORNLCBLI-OAHLVZFQSA-N |
| XLogP | 5.62 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|