About (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol
(3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol (PubChem CID 87287397) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol |
| PubChem CID | 87287397 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol |
| SMILES | C=C(/C=C(\N)C(C)(C)O)NCCO |
| InChI | InChI=1S/C9H18N2O2/c1-7(11-4-5-12)6-8(10)9(2,3)13/h6,11-13H,1,4-5,10H2,2-3H3/b8-6- |
| InChIKey | GXGXUMAVVAEYHP-VURMDHGXSA-N |
| XLogP | -0.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol?
The IUPAC name of (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol (CID 87287397) is (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol.
What is the SMILES notation for (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol?
The canonical SMILES for (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol is C=C(/C=C(\N)C(C)(C)O)NCCO.
What is the InChIKey of (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol?
The InChIKey is GXGXUMAVVAEYHP-VURMDHGXSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-7(11-4-5-12)6-8(10)9(2,3)13/h6,11-13H,1,4-5,10H2,2-3H3/b8-6-.
What are the key properties of (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol?
(3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol has a molecular weight of 186.25 g/mol, XLogP of -0.30, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-amino-5-(2-hydroxyethylamino)-2-methylhexa-3,5-dien-2-ol is sourced from PubChem (CID 87287397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).