C24H20Cl2F5N3O4 — CID 87289473
(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-1-(1,1-difluoro-2-fluorooxy-2-oxoethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid (PubChem CID 87289473) has the molecular formula C24H20Cl2F5N3O4 and a molecular weight of 580.34 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-1-(1,1-difluoro-2-fluorooxy-2-oxoethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-1-(1,1-difluoro-2-fluorooxy-2-oxoethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87289473 |
| Molecular Formula | C24H20Cl2F5N3O4 |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(5-chloro-3-fluoro-2-pyridinyl)-4-cyano-1-(1,1-difluoro-2-fluorooxy-2-oxoethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N(C(F)(F)C(=O)OF)[C@@H](C(=O)O)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ncc(Cl)cc1F |
| InChI | InChI=1S/C24H20Cl2F5N3O4/c1-22(2,3)8-15-23(10-32,19-14(27)7-11(25)9-33-19)16(12-5-4-6-13(26)17(12)28)18(20(35)36)34(15)24(29,30)21(37)38-31/h4-7,9,15-16,18H,8H2,1-3H3,(H,35,36)/t15-,16-,18+,23-/m0/s1 |
| InChIKey | CXWDZTYOMNADEG-KNESASJNSA-N |
| XLogP | 5.81 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|