C27H31N3O6S — CID 87292071
(2R)-N-hydroxy-4-[(2-phenylacetyl)amino]-2-[(4-phenyl-3-propan-2-yloxyphenyl)sulfonylamino]butanamide (PubChem CID 87292071) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[(2-phenylacetyl)amino]-2-[(4-phenyl-3-propan-2-yloxyphenyl)sulfonylamino]butanamide.
| Compound Name | (2R)-N-hydroxy-4-[(2-phenylacetyl)amino]-2-[(4-phenyl-3-propan-2-yloxyphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 87292071 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (2R)-N-hydroxy-4-[(2-phenylacetyl)amino]-2-[(4-phenyl-3-propan-2-yloxyphenyl)sulfonylamino]butanamide |
| SMILES | CC(C)Oc1cc(S(=O)(=O)N[C@H](CCNC(=O)Cc2ccccc2)C(=O)NO)ccc1-c1ccccc1 |
| InChI | InChI=1S/C27H31N3O6S/c1-19(2)36-25-18-22(13-14-23(25)21-11-7-4-8-12-21)37(34,35)30-24(27(32)29-33)15-16-28-26(31)17-20-9-5-3-6-10-20/h3-14,18-19,24,30,33H,15-17H2,1-2H3,(H,28,31)(H,29,32)/t24-/m1/s1 |
| InChIKey | QDEDMSXJEKPQOE-XMMPIXPASA-N |
| XLogP | 3.04 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|