C18H12ClF2N3O — CID 87293309
N-(2-chloro-4-pyridinyl)-4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxamide (PubChem CID 87293309) has the molecular formula C18H12ClF2N3O and a molecular weight of 359.76 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 87293309 |
| Molecular Formula | C18H12ClF2N3O |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(-c2cc(F)cc(F)c2)cc(C(=O)Nc2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C18H12ClF2N3O/c1-10-4-11(12-5-13(20)8-14(21)6-12)7-16(23-10)18(25)24-15-2-3-22-17(19)9-15/h2-9H,1H3,(H,22,24,25) |
| InChIKey | HPNJQIGBOVVBGP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|