C7H12BrF3O4Si — CID 87294168
3-[bromo(dimethoxy)silyl]propyl 2,2,2-trifluoroacetate (PubChem CID 87294168) has the molecular formula C7H12BrF3O4Si and a molecular weight of 325.15 g/mol. Its IUPAC name is 3-[bromo(dimethoxy)silyl]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[bromo(dimethoxy)silyl]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87294168 |
| Molecular Formula | C7H12BrF3O4Si |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 3-[bromo(dimethoxy)silyl]propyl 2,2,2-trifluoroacetate |
| SMILES | CO[Si](Br)(CCCOC(=O)C(F)(F)F)OC |
| InChI | InChI=1S/C7H12BrF3O4Si/c1-13-16(8,14-2)5-3-4-15-6(12)7(9,10)11/h3-5H2,1-2H3 |
| InChIKey | KVZFPELRKHQCCG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|