C15H17NO3S — CID 87294595
2-(4-methoxycarbonyl-1-methyl-2,3-dihydro-1-benzazepin-7-yl)ethanethioic S-acid (PubChem CID 87294595) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(4-methoxycarbonyl-1-methyl-2,3-dihydro-1-benzazepin-7-yl)ethanethioic S-acid.
| Compound Name | 2-(4-methoxycarbonyl-1-methyl-2,3-dihydro-1-benzazepin-7-yl)ethanethioic S-acid |
|---|---|
| PubChem CID | 87294595 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(4-methoxycarbonyl-1-methyl-2,3-dihydro-1-benzazepin-7-yl)ethanethioic S-acid |
| SMILES | COC(=O)C1=Cc2cc(CC(=O)S)ccc2N(C)CC1 |
| InChI | InChI=1S/C15H17NO3S/c1-16-6-5-11(15(18)19-2)9-12-7-10(8-14(17)20)3-4-13(12)16/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,20) |
| InChIKey | RKWFAWMGRWETOC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|