C19H18F4O3 — CID 87295486
2-[3,5-di(propan-2-yloxy)phenyl]-3,4,5,6-tetrafluorobenzaldehyde (PubChem CID 87295486) has the molecular formula C19H18F4O3 and a molecular weight of 370.34 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yloxy)phenyl]-3,4,5,6-tetrafluorobenzaldehyde.
| Compound Name | 2-[3,5-di(propan-2-yloxy)phenyl]-3,4,5,6-tetrafluorobenzaldehyde |
|---|---|
| PubChem CID | 87295486 |
| Molecular Formula | C19H18F4O3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[3,5-di(propan-2-yloxy)phenyl]-3,4,5,6-tetrafluorobenzaldehyde |
| SMILES | CC(C)Oc1cc(OC(C)C)cc(-c2c(F)c(F)c(F)c(F)c2C=O)c1 |
| InChI | InChI=1S/C19H18F4O3/c1-9(2)25-12-5-11(6-13(7-12)26-10(3)4)15-14(8-24)16(20)18(22)19(23)17(15)21/h5-10H,1-4H3 |
| InChIKey | VUOXPSRRTASXEH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|