About formyloxymethyl 3-methylimidazole-4-carboxylate
formyloxymethyl 3-methylimidazole-4-carboxylate (PubChem CID 87296370) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is formyloxymethyl 3-methylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | formyloxymethyl 3-methylimidazole-4-carboxylate |
| PubChem CID | 87296370 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | formyloxymethyl 3-methylimidazole-4-carboxylate |
| SMILES | Cn1cncc1C(=O)OCOC=O |
| InChI | InChI=1S/C7H8N2O4/c1-9-3-8-2-6(9)7(11)13-5-12-4-10/h2-4H,5H2,1H3 |
| InChIKey | FOWIHBLXUBOFNM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze formyloxymethyl 3-methylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyloxymethyl 3-methylimidazole-4-carboxylate?
The IUPAC name of formyloxymethyl 3-methylimidazole-4-carboxylate (CID 87296370) is formyloxymethyl 3-methylimidazole-4-carboxylate.
What is the SMILES notation for formyloxymethyl 3-methylimidazole-4-carboxylate?
The canonical SMILES for formyloxymethyl 3-methylimidazole-4-carboxylate is Cn1cncc1C(=O)OCOC=O.
What is the InChIKey of formyloxymethyl 3-methylimidazole-4-carboxylate?
The InChIKey is FOWIHBLXUBOFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-9-3-8-2-6(9)7(11)13-5-12-4-10/h2-4H,5H2,1H3.
What are the key properties of formyloxymethyl 3-methylimidazole-4-carboxylate?
formyloxymethyl 3-methylimidazole-4-carboxylate has a molecular weight of 184.15 g/mol, XLogP of -0.29, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formyloxymethyl 3-methylimidazole-4-carboxylate is sourced from PubChem (CID 87296370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).