About 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate
1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate (PubChem CID 87296410) has the molecular formula C18H20O4S
and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate.
Molecular Properties
| Compound Name | 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate |
| PubChem CID | 87296410 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate |
| SMILES | O=S(=O)(OC12CCC(CC1)CC2)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H20O4S/c19-17-15-4-2-1-3-14(15)5-6-16(17)23(20,21)22-18-10-7-13(8-11-18)9-12-18/h1-6,13,19H,7-12H2 |
| InChIKey | KIXVCLJUMAXZED-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate?
The IUPAC name of 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate (CID 87296410) is 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate.
What is the SMILES notation for 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate?
The canonical SMILES for 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate is O=S(=O)(OC12CCC(CC1)CC2)c1ccc2ccccc2c1O.
What is the InChIKey of 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate?
The InChIKey is KIXVCLJUMAXZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4S/c19-17-15-4-2-1-3-14(15)5-6-16(17)23(20,21)22-18-10-7-13(8-11-18)9-12-18/h1-6,13,19H,7-12H2.
What are the key properties of 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate?
1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate has a molecular weight of 332.42 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[2.2.2]octanyl 1-hydroxynaphthalene-2-sulfonate is sourced from PubChem (CID 87296410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).