About 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid
1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid (PubChem CID 87299443) has the molecular formula C20H41NO6
and a molecular weight of 391.55 g/mol. Its IUPAC name is 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid.
Molecular Properties
| Compound Name | 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid |
| PubChem CID | 87299443 |
| Molecular Formula | C20H41NO6 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid |
| SMILES | CCCCCCCCCCCC(C(=O)O)C(=O)O.COC(C)NC(C)OC |
| InChI | InChI=1S/C14H26O4.C6H15NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13(15)16)14(17)18;1-5(8-3)7-6(2)9-4/h12H,2-11H2,1H3,(H,15,16)(H,17,18);5-7H,1-4H3 |
| InChIKey | FBVYSKVAMKSYHO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid?
The IUPAC name of 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid (CID 87299443) is 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid.
What is the SMILES notation for 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid?
The canonical SMILES for 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid is CCCCCCCCCCCC(C(=O)O)C(=O)O.COC(C)NC(C)OC.
What is the InChIKey of 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid?
The InChIKey is FBVYSKVAMKSYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.C6H15NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13(15)16)14(17)18;1-5(8-3)7-6(2)9-4/h12H,2-11H2,1H3,(H,15,16)(H,17,18);5-7H,1-4H3.
What are the key properties of 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid?
1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid has a molecular weight of 391.55 g/mol, XLogP of 4.25, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N-(1-methoxyethyl)ethanamine;2-undecylpropanedioic acid is sourced from PubChem (CID 87299443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).