C12H23NO9 — CID 87299512
2-hydroxypropane-1,2,3-tricarboxylic acid;1-methoxy-N-(1-methoxyethyl)ethanamine (PubChem CID 87299512) has the molecular formula C12H23NO9 and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;1-methoxy-N-(1-methoxyethyl)ethanamine.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-methoxy-N-(1-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 87299512 |
| Molecular Formula | C12H23NO9 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-methoxy-N-(1-methoxyethyl)ethanamine |
| SMILES | COC(C)NC(C)OC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H15NO2.C6H8O7/c1-5(8-3)7-6(2)9-4;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-7H,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | WONRCDDQMMPOSC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|