About 4,7-diaminoheptyl undecanoate
4,7-diaminoheptyl undecanoate (PubChem CID 87299658) has the molecular formula C18H38N2O2
and a molecular weight of 314.51 g/mol. Its IUPAC name is 4,7-diaminoheptyl undecanoate.
Molecular Properties
| Compound Name | 4,7-diaminoheptyl undecanoate |
| PubChem CID | 87299658 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | 4,7-diaminoheptyl undecanoate |
| SMILES | CCCCCCCCCCC(=O)OCCCC(N)CCCN |
| InChI | InChI=1S/C18H38N2O2/c1-2-3-4-5-6-7-8-9-14-18(21)22-16-11-13-17(20)12-10-15-19/h17H,2-16,19-20H2,1H3 |
| InChIKey | WCCVTQAEKCSSSN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diaminoheptyl undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diaminoheptyl undecanoate?
The IUPAC name of 4,7-diaminoheptyl undecanoate (CID 87299658) is 4,7-diaminoheptyl undecanoate.
What is the SMILES notation for 4,7-diaminoheptyl undecanoate?
The canonical SMILES for 4,7-diaminoheptyl undecanoate is CCCCCCCCCCC(=O)OCCCC(N)CCCN.
What is the InChIKey of 4,7-diaminoheptyl undecanoate?
The InChIKey is WCCVTQAEKCSSSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O2/c1-2-3-4-5-6-7-8-9-14-18(21)22-16-11-13-17(20)12-10-15-19/h17H,2-16,19-20H2,1H3.
What are the key properties of 4,7-diaminoheptyl undecanoate?
4,7-diaminoheptyl undecanoate has a molecular weight of 314.51 g/mol, XLogP of 3.91, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diaminoheptyl undecanoate is sourced from PubChem (CID 87299658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).