C13H14N2O4S — CID 8729981
[(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] (2R)-oxolane-2-carboxylate (PubChem CID 8729981) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] (2R)-oxolane-2-carboxylate.
| Compound Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 8729981 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] (2R)-oxolane-2-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1CCCO1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C13H14N2O4S/c1-8(19-13(17)10-3-2-5-18-10)11(16)15-12-9(7-14)4-6-20-12/h4,6,8,10H,2-3,5H2,1H3,(H,15,16)/t8-,10-/m1/s1 |
| InChIKey | APJBPNKJMOSLCH-PSASIEDQSA-N |
| XLogP | 1.67 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |