About propan-2-yl (2S)-2-aminohexanoate
propan-2-yl (2S)-2-aminohexanoate (PubChem CID 87300314) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is propan-2-yl (2S)-2-aminohexanoate.
Molecular Properties
| Compound Name | propan-2-yl (2S)-2-aminohexanoate |
| PubChem CID | 87300314 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | propan-2-yl (2S)-2-aminohexanoate |
| SMILES | CCCC[C@H](N)C(=O)OC(C)C |
| InChI | InChI=1S/C9H19NO2/c1-4-5-6-8(10)9(11)12-7(2)3/h7-8H,4-6,10H2,1-3H3/t8-/m0/s1 |
| InChIKey | VIWSPMCLHUDILU-QMMMGPOBSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (2S)-2-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-2-aminohexanoate?
The IUPAC name of propan-2-yl (2S)-2-aminohexanoate (CID 87300314) is propan-2-yl (2S)-2-aminohexanoate.
What is the SMILES notation for propan-2-yl (2S)-2-aminohexanoate?
The canonical SMILES for propan-2-yl (2S)-2-aminohexanoate is CCCC[C@H](N)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (2S)-2-aminohexanoate?
The InChIKey is VIWSPMCLHUDILU-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-5-6-8(10)9(11)12-7(2)3/h7-8H,4-6,10H2,1-3H3/t8-/m0/s1.
What are the key properties of propan-2-yl (2S)-2-aminohexanoate?
propan-2-yl (2S)-2-aminohexanoate has a molecular weight of 173.26 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-2-aminohexanoate is sourced from PubChem (CID 87300314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).