C18H16F3N3OS — CID 87301474
N-[5-cyano-4-(2,4,5-trifluoro-3-methylphenyl)-1,3-thiazol-2-yl]cyclohexanecarboxamide (PubChem CID 87301474) has the molecular formula C18H16F3N3OS and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[5-cyano-4-(2,4,5-trifluoro-3-methylphenyl)-1,3-thiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[5-cyano-4-(2,4,5-trifluoro-3-methylphenyl)-1,3-thiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87301474 |
| Molecular Formula | C18H16F3N3OS |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[5-cyano-4-(2,4,5-trifluoro-3-methylphenyl)-1,3-thiazol-2-yl]cyclohexanecarboxamide |
| SMILES | Cc1c(F)c(F)cc(-c2nc(NC(=O)C3CCCCC3)sc2C#N)c1F |
| InChI | InChI=1S/C18H16F3N3OS/c1-9-14(20)11(7-12(19)15(9)21)16-13(8-22)26-18(23-16)24-17(25)10-5-3-2-4-6-10/h7,10H,2-6H2,1H3,(H,23,24,25) |
| InChIKey | WHAJMNVUKIWEEW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|