C25H28FN5O2 — CID 87302384
N-[2-[2-(3-fluorophenyl)ethylamino]-6-[(3S)-3-hydroxypiperidin-1-yl]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide (PubChem CID 87302384) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[2-[2-(3-fluorophenyl)ethylamino]-6-[(3S)-3-hydroxypiperidin-1-yl]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide.
| Compound Name | N-[2-[2-(3-fluorophenyl)ethylamino]-6-[(3S)-3-hydroxypiperidin-1-yl]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
|---|---|
| PubChem CID | 87302384 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[2-[2-(3-fluorophenyl)ethylamino]-6-[(3S)-3-hydroxypiperidin-1-yl]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
| SMILES | O=CN(Cc1cccnc1)c1ccc(N2CCC[C@H](O)C2)nc1NCCc1cccc(F)c1 |
| InChI | InChI=1S/C25H28FN5O2/c26-21-6-1-4-19(14-21)10-12-28-25-23(31(18-32)16-20-5-2-11-27-15-20)8-9-24(29-25)30-13-3-7-22(33)17-30/h1-2,4-6,8-9,11,14-15,18,22,33H,3,7,10,12-13,16-17H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | MRXDWYRKNBKTDW-QFIPXVFZSA-N |
| XLogP | 3.39 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|