C28H21FN6O — CID 87269203
N-[5-cyano-6-(2-cyanophenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide (PubChem CID 87269203) has the molecular formula C28H21FN6O and a molecular weight of 476.52 g/mol. Its IUPAC name is N-[5-cyano-6-(2-cyanophenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide.
| Compound Name | N-[5-cyano-6-(2-cyanophenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
|---|---|
| PubChem CID | 87269203 |
| Molecular Formula | C28H21FN6O |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[5-cyano-6-(2-cyanophenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
| SMILES | N#Cc1ccccc1-c1nc(NCCc2cccc(F)c2)c(N(C=O)Cc2cccnc2)cc1C#N |
| InChI | InChI=1S/C28H21FN6O/c29-24-8-3-5-20(13-24)10-12-33-28-26(35(19-36)18-21-6-4-11-32-17-21)14-23(16-31)27(34-28)25-9-2-1-7-22(25)15-30/h1-9,11,13-14,17,19H,10,12,18H2,(H,33,34) |
| InChIKey | LUCDEZYAVVTWSQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|