C21H18FN5O — CID 87307244
N-[5-cyano-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-2-ylmethyl)formamide (PubChem CID 87307244) has the molecular formula C21H18FN5O and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[5-cyano-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-2-ylmethyl)formamide.
| Compound Name | N-[5-cyano-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 87307244 |
| Molecular Formula | C21H18FN5O |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[5-cyano-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-N-(pyridin-2-ylmethyl)formamide |
| SMILES | N#Cc1cnc(NCCc2cccc(F)c2)c(N(C=O)Cc2ccccn2)c1 |
| InChI | InChI=1S/C21H18FN5O/c22-18-5-3-4-16(10-18)7-9-25-21-20(11-17(12-23)13-26-21)27(15-28)14-19-6-1-2-8-24-19/h1-6,8,10-11,13,15H,7,9,14H2,(H,25,26) |
| InChIKey | WXJISSDGTBFNDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|