C25H21FN4O2S — CID 87269605
N-[2-[2-(3-fluorophenyl)ethylamino]-6-(5-formylthiophen-2-yl)-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide (PubChem CID 87269605) has the molecular formula C25H21FN4O2S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[2-[2-(3-fluorophenyl)ethylamino]-6-(5-formylthiophen-2-yl)-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide.
| Compound Name | N-[2-[2-(3-fluorophenyl)ethylamino]-6-(5-formylthiophen-2-yl)-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
|---|---|
| PubChem CID | 87269605 |
| Molecular Formula | C25H21FN4O2S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[2-[2-(3-fluorophenyl)ethylamino]-6-(5-formylthiophen-2-yl)-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
| SMILES | O=Cc1ccc(-c2ccc(N(C=O)Cc3cccnc3)c(NCCc3cccc(F)c3)n2)s1 |
| InChI | InChI=1S/C25H21FN4O2S/c26-20-5-1-3-18(13-20)10-12-28-25-23(30(17-32)15-19-4-2-11-27-14-19)8-7-22(29-25)24-9-6-21(16-31)33-24/h1-9,11,13-14,16-17H,10,12,15H2,(H,28,29) |
| InChIKey | QPFRJOARSCEVHO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|