C25H27N5O2 — CID 87269486
N-[2-[2-(2-oxopiperidin-1-yl)ethylamino]-6-phenyl-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide (PubChem CID 87269486) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-[2-(2-oxopiperidin-1-yl)ethylamino]-6-phenyl-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide.
| Compound Name | N-[2-[2-(2-oxopiperidin-1-yl)ethylamino]-6-phenyl-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
|---|---|
| PubChem CID | 87269486 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[2-[2-(2-oxopiperidin-1-yl)ethylamino]-6-phenyl-3-pyridinyl]-N-(pyridin-3-ylmethyl)formamide |
| SMILES | O=CN(Cc1cccnc1)c1ccc(-c2ccccc2)nc1NCCN1CCCCC1=O |
| InChI | InChI=1S/C25H27N5O2/c31-19-30(18-20-7-6-13-26-17-20)23-12-11-22(21-8-2-1-3-9-21)28-25(23)27-14-16-29-15-5-4-10-24(29)32/h1-3,6-9,11-13,17,19H,4-5,10,14-16,18H2,(H,27,28) |
| InChIKey | QWFMCXGMJFXLSH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|