C18H22N2O6S — CID 8731192
[(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-methoxyphenyl)propanoate (PubChem CID 8731192) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-methoxyphenyl)propanoate.
| Compound Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 8731192 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)O[C@H](C)C(=O)NCCN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C18H22N2O6S/c1-12(17(23)19-9-10-20-15(21)11-27-18(20)24)26-16(22)8-5-13-3-6-14(25-2)7-4-13/h3-4,6-7,12H,5,8-11H2,1-2H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | DRRJJEUPOKBNDH-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|