C16H17FN2O5S — CID 9387298
[(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate (PubChem CID 9387298) has the molecular formula C16H17FN2O5S and a molecular weight of 368.39 g/mol. Its IUPAC name is [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate.
| Compound Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9387298 |
| Molecular Formula | C16H17FN2O5S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H](C)C(=O)NCCN2C(=O)CSC2=O)cc1F |
| InChI | InChI=1S/C16H17FN2O5S/c1-9-3-4-11(7-12(9)17)15(22)24-10(2)14(21)18-5-6-19-13(20)8-25-16(19)23/h3-4,7,10H,5-6,8H2,1-2H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | CXBWIGGUFFXCEF-SNVBAGLBSA-N |
| XLogP | 1.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|