C18H21N3O6S — CID 9061153
[(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 2-(4-acetamidophenyl)acetate (PubChem CID 9061153) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 2-(4-acetamidophenyl)acetate.
| Compound Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 2-(4-acetamidophenyl)acetate |
|---|---|
| PubChem CID | 9061153 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [(2R)-1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-1-oxopropan-2-yl] 2-(4-acetamidophenyl)acetate |
| SMILES | CC(=O)Nc1ccc(CC(=O)O[C@H](C)C(=O)NCCN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C18H21N3O6S/c1-11(17(25)19-7-8-21-15(23)10-28-18(21)26)27-16(24)9-13-3-5-14(6-4-13)20-12(2)22/h3-6,11H,7-10H2,1-2H3,(H,19,25)(H,20,22)/t11-/m1/s1 |
| InChIKey | ALYWOIHACCGYIC-LLVKDONJSA-N |
| XLogP | 0.93 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|