About N-benzhydryl-3,5-dimethoxybenzamide
N-benzhydryl-3,5-dimethoxybenzamide (PubChem CID 873122) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is N-benzhydryl-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-benzhydryl-3,5-dimethoxybenzamide |
| PubChem CID | 873122 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-benzhydryl-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO3/c1-25-19-13-18(14-20(15-19)26-2)22(24)23-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,21H,1-2H3,(H,23,24) |
| InChIKey | FOGQPQUPSOUSKC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzhydryl-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-3,5-dimethoxybenzamide?
The IUPAC name of N-benzhydryl-3,5-dimethoxybenzamide (CID 873122) is N-benzhydryl-3,5-dimethoxybenzamide.
What is the SMILES notation for N-benzhydryl-3,5-dimethoxybenzamide?
The canonical SMILES for N-benzhydryl-3,5-dimethoxybenzamide is COc1cc(OC)cc(C(=O)NC(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of N-benzhydryl-3,5-dimethoxybenzamide?
The InChIKey is FOGQPQUPSOUSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c1-25-19-13-18(14-20(15-19)26-2)22(24)23-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,21H,1-2H3,(H,23,24).
What are the key properties of N-benzhydryl-3,5-dimethoxybenzamide?
N-benzhydryl-3,5-dimethoxybenzamide has a molecular weight of 347.41 g/mol, XLogP of 4.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-3,5-dimethoxybenzamide is sourced from PubChem (CID 873122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).