C23H27FN4O5 — CID 87314869
(2R)-2-[(2R)-4-(4-tert-butylphenyl)-3-oxomorpholin-2-yl]-N-[2-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-hydroxyacetamide (PubChem CID 87314869) has the molecular formula C23H27FN4O5 and a molecular weight of 458.49 g/mol. Its IUPAC name is (2R)-2-[(2R)-4-(4-tert-butylphenyl)-3-oxomorpholin-2-yl]-N-[2-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-hydroxyacetamide.
| Compound Name | (2R)-2-[(2R)-4-(4-tert-butylphenyl)-3-oxomorpholin-2-yl]-N-[2-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 87314869 |
| Molecular Formula | C23H27FN4O5 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (2R)-2-[(2R)-4-(4-tert-butylphenyl)-3-oxomorpholin-2-yl]-N-[2-fluoro-4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-hydroxyacetamide |
| SMILES | CC(C)(C)c1ccc(N2CCO[C@H]([C@@H](O)C(=O)Nc3ccc(/C(N)=N/O)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C23H27FN4O5/c1-23(2,3)14-5-7-15(8-6-14)28-10-11-33-19(22(28)31)18(29)21(30)26-17-9-4-13(12-16(17)24)20(25)27-32/h4-9,12,18-19,29,32H,10-11H2,1-3H3,(H2,25,27)(H,26,30)/t18-,19-/m1/s1 |
| InChIKey | HOLSWSJLXAVEHP-RTBURBONSA-N |
| XLogP | 1.95 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|