C22H25N5O5 — CID 90717427
2-[4-(4-acetamidophenyl)-3-oxomorpholin-2-yl]-2-hydroxy-N-[4-(N'-methylcarbamimidoyl)phenyl]acetamide (PubChem CID 90717427) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[4-(4-acetamidophenyl)-3-oxomorpholin-2-yl]-2-hydroxy-N-[4-(N'-methylcarbamimidoyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-acetamidophenyl)-3-oxomorpholin-2-yl]-2-hydroxy-N-[4-(N'-methylcarbamimidoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 90717427 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[4-(4-acetamidophenyl)-3-oxomorpholin-2-yl]-2-hydroxy-N-[4-(N'-methylcarbamimidoyl)phenyl]acetamide |
| SMILES | C/N=C(\N)c1ccc(NC(=O)C(O)C2OCCN(c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N5O5/c1-13(28)25-15-7-9-17(10-8-15)27-11-12-32-19(22(27)31)18(29)21(30)26-16-5-3-14(4-6-16)20(23)24-2/h3-10,18-19,29H,11-12H2,1-2H3,(H2,23,24)(H,25,28)(H,26,30) |
| InChIKey | ZUTCVRDGZWRJTH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|