C24H28N6O7S — CID 118501227
(2R)-N-(4-carbamohydrazonoylphenyl)-2-[(2R)-4-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetamide (PubChem CID 118501227) has the molecular formula C24H28N6O7S and a molecular weight of 544.59 g/mol. Its IUPAC name is (2R)-N-(4-carbamohydrazonoylphenyl)-2-[(2R)-4-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetamide.
| Compound Name | (2R)-N-(4-carbamohydrazonoylphenyl)-2-[(2R)-4-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 118501227 |
| Molecular Formula | C24H28N6O7S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (2R)-N-(4-carbamohydrazonoylphenyl)-2-[(2R)-4-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
| SMILES | NN=C(N)c1ccc(NC(=O)[C@H](O)[C@H]2OCCN(c3ccc(C(=O)N4CCS(=O)(=O)CC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H28N6O7S/c25-21(28-26)15-1-5-17(6-2-15)27-22(32)19(31)20-24(34)30(9-12-37-20)18-7-3-16(4-8-18)23(33)29-10-13-38(35,36)14-11-29/h1-8,19-20,31H,9-14,26H2,(H2,25,28)(H,27,32)/t19-,20-/m1/s1 |
| InChIKey | TVODNUDLYDLBAJ-WOJBJXKFSA-N |
| XLogP | -1.13 |
| TPSA | 197.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|