C13H17NO2 — CID 87315844
(2E)-2-hydroxyimino-4,5,5,7-tetramethyl-3,4-dihydroinden-1-one (PubChem CID 87315844) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-4,5,5,7-tetramethyl-3,4-dihydroinden-1-one.
| Compound Name | (2E)-2-hydroxyimino-4,5,5,7-tetramethyl-3,4-dihydroinden-1-one |
|---|---|
| PubChem CID | 87315844 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2E)-2-hydroxyimino-4,5,5,7-tetramethyl-3,4-dihydroinden-1-one |
| SMILES | CC1=CC(C)(C)C(C)C2=C1C(=O)/C(=N/O)C2 |
| InChI | InChI=1S/C13H17NO2/c1-7-6-13(3,4)8(2)9-5-10(14-16)12(15)11(7)9/h6,8,16H,5H2,1-4H3/b14-10+ |
| InChIKey | HYYGWOFFAXXJKH-GXDHUFHOSA-N |
| XLogP | 2.71 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|