C14H30O4Ti — CID 87320537
titanium;1,1,2-tris(2-methylpropoxy)ethanol (PubChem CID 87320537) has the molecular formula C14H30O4Ti and a molecular weight of 310.26 g/mol. Its IUPAC name is titanium;1,1,2-tris(2-methylpropoxy)ethanol.
| Compound Name | titanium;1,1,2-tris(2-methylpropoxy)ethanol |
|---|---|
| PubChem CID | 87320537 |
| Molecular Formula | C14H30O4Ti |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | titanium;1,1,2-tris(2-methylpropoxy)ethanol |
| SMILES | CC(C)COCC(O)(OCC(C)C)OCC(C)C.[Ti] |
| InChI | InChI=1S/C14H30O4.Ti/c1-11(2)7-16-10-14(15,17-8-12(3)4)18-9-13(5)6;/h11-13,15H,7-10H2,1-6H3; |
| InChIKey | GGZAISRDATXRDO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|