C22H16Cl2F6N4O4 — CID 87323758
6-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4-methyl-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]pyridine-3-carboxamide (PubChem CID 87323758) has the molecular formula C22H16Cl2F6N4O4 and a molecular weight of 585.29 g/mol. Its IUPAC name is 6-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4-methyl-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4-methyl-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87323758 |
| Molecular Formula | C22H16Cl2F6N4O4 |
| Molecular Weight | 585.29 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | 6-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4-methyl-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ncc1C(=O)NC1CON(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C22H16Cl2F6N4O4/c1-10-2-15(16-6-20(38-33-16,22(28,29)30)11-3-12(23)5-13(24)4-11)31-7-14(10)18(35)32-17-8-37-34(19(17)36)9-21(25,26)27/h2-5,7,17H,6,8-9H2,1H3,(H,32,35) |
| InChIKey | MPCCZEUMLWRARW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |