C12H26N4O4 — CID 87326195
5,5-diamino-5-[[(1S)-5-amino-1-carboxypentyl]amino]-2-methylpentanoic acid (PubChem CID 87326195) has the molecular formula C12H26N4O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5,5-diamino-5-[[(1S)-5-amino-1-carboxypentyl]amino]-2-methylpentanoic acid.
| Compound Name | 5,5-diamino-5-[[(1S)-5-amino-1-carboxypentyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 87326195 |
| Molecular Formula | C12H26N4O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 5,5-diamino-5-[[(1S)-5-amino-1-carboxypentyl]amino]-2-methylpentanoic acid |
| SMILES | CC(CCC(N)(N)N[C@@H](CCCCN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H26N4O4/c1-8(10(17)18)5-6-12(14,15)16-9(11(19)20)4-2-3-7-13/h8-9,16H,2-7,13-15H2,1H3,(H,17,18)(H,19,20)/t8?,9-/m0/s1 |
| InChIKey | QDVAOJGILNNDDJ-GKAPJAKFSA-N |
| XLogP | -0.77 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|