C14H12F3N3O3 — CID 87329270
N-phenylmethoxy-N-[4-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]formamide (PubChem CID 87329270) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is N-phenylmethoxy-N-[4-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]formamide.
| Compound Name | N-phenylmethoxy-N-[4-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]formamide |
|---|---|
| PubChem CID | 87329270 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-phenylmethoxy-N-[4-(2,2,2-trifluoro-1-hydroxyethyl)pyrimidin-2-yl]formamide |
| SMILES | O=CN(OCc1ccccc1)c1nccc(C(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F3N3O3/c15-14(16,17)12(22)11-6-7-18-13(19-11)20(9-21)23-8-10-4-2-1-3-5-10/h1-7,9,12,22H,8H2 |
| InChIKey | MVMBSJMOWXDNTL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|