C21H24F3N5O3 — CID 87739069
N-[1-cyclohexyl-2-oxo-2-[2-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazinyl]ethyl]-N-phenylmethoxyformamide (PubChem CID 87739069) has the molecular formula C21H24F3N5O3 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-oxo-2-[2-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazinyl]ethyl]-N-phenylmethoxyformamide.
| Compound Name | N-[1-cyclohexyl-2-oxo-2-[2-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazinyl]ethyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 87739069 |
| Molecular Formula | C21H24F3N5O3 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[1-cyclohexyl-2-oxo-2-[2-[4-(trifluoromethyl)pyrimidin-2-yl]hydrazinyl]ethyl]-N-phenylmethoxyformamide |
| SMILES | O=CN(OCc1ccccc1)C(C(=O)NNc1nccc(C(F)(F)F)n1)C1CCCCC1 |
| InChI | InChI=1S/C21H24F3N5O3/c22-21(23,24)17-11-12-25-20(26-17)28-27-19(31)18(16-9-5-2-6-10-16)29(14-30)32-13-15-7-3-1-4-8-15/h1,3-4,7-8,11-12,14,16,18H,2,5-6,9-10,13H2,(H,27,31)(H,25,26,28) |
| InChIKey | LJVIXSHJHYHQOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|