C20H18F2N2O4 — CID 87998487
(1S,5R)-3-[2,6-difluoro-4-[formyl(phenylmethoxy)amino]phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 87998487) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is (1S,5R)-3-[2,6-difluoro-4-[formyl(phenylmethoxy)amino]phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | (1S,5R)-3-[2,6-difluoro-4-[formyl(phenylmethoxy)amino]phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 87998487 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (1S,5R)-3-[2,6-difluoro-4-[formyl(phenylmethoxy)amino]phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | O=CN(OCc1ccccc1)c1cc(F)c(N2C[C@@H]3C(C(=O)O)[C@@H]3C2)c(F)c1 |
| InChI | InChI=1S/C20H18F2N2O4/c21-16-6-13(24(11-25)28-10-12-4-2-1-3-5-12)7-17(22)19(16)23-8-14-15(9-23)18(14)20(26)27/h1-7,11,14-15,18H,8-10H2,(H,26,27)/t14-,15+,18? |
| InChIKey | PIPOYCTVHRJOLA-MVVMVCHASA-N |
| XLogP | 2.83 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|