C33H38F6N4O6 — CID 87331430
2-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331430) has the molecular formula C33H38F6N4O6 and a molecular weight of 700.68 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-1-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 2-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331430 |
| Molecular Formula | C33H38F6N4O6 |
| Molecular Weight | 700.68 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | 2-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-1-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1c2ccccc2CC[NH+]1C)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H36N4O2.2C2HF3O2/c1-3-23(34)15-8-5-9-17-25(28-30-20-26(31-28)22-13-6-4-7-14-22)32-29(35)27-24-16-11-10-12-21(24)18-19-33(27)2;2*3-2(4,5)1(6)7/h4,6-7,10-14,16,20,25,27H,3,5,8-9,15,17-19H2,1-2H3,(H,30,31)(H,32,35);2*(H,6,7)/t25-,27?;;/m0../s1 |
| InChIKey | AHSVHDFPXKGQSS-UREPZUBFSA-N |
| XLogP | 0.78 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.68 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|