C31H33F3N4O4 — CID 87331466
(7S)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-[(2-phenylacetyl)amino]heptanamide;2,2,2-trifluoroacetate (PubChem CID 87331466) has the molecular formula C31H33F3N4O4 and a molecular weight of 582.62 g/mol. Its IUPAC name is (7S)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-[(2-phenylacetyl)amino]heptanamide;2,2,2-trifluoroacetate.
| Compound Name | (7S)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-[(2-phenylacetyl)amino]heptanamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331466 |
| Molecular Formula | C31H33F3N4O4 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | (7S)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-[(2-phenylacetyl)amino]heptanamide;2,2,2-trifluoroacetate |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)Cc1ccccc1)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H32N4O2.C2HF3O2/c1-30-27(34)15-7-3-6-14-25(32-28(35)18-21-10-4-2-5-11-21)29-31-20-26(33-29)24-17-16-22-12-8-9-13-23(22)19-24;3-2(4,5)1(6)7/h2,4-5,8-13,16-17,19-20,25H,3,6-7,14-15,18H2,1H3,(H,30,34)(H,31,33)(H,32,35);(H,6,7)/t25-;/m0./s1 |
| InChIKey | VRZROGSUFIYRDA-UQIIZPHYSA-N |
| XLogP | 2.84 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|