C21H17Cl3O2 — CID 87332732
[(E)-4-(4-chlorophenyl)but-3-en-2-yl] (2E,4E)-5-(2,4-dichlorophenyl)penta-2,4-dienoate (PubChem CID 87332732) has the molecular formula C21H17Cl3O2 and a molecular weight of 407.72 g/mol. Its IUPAC name is [(E)-4-(4-chlorophenyl)but-3-en-2-yl] (2E,4E)-5-(2,4-dichlorophenyl)penta-2,4-dienoate.
| Compound Name | [(E)-4-(4-chlorophenyl)but-3-en-2-yl] (2E,4E)-5-(2,4-dichlorophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 87332732 |
| Molecular Formula | C21H17Cl3O2 |
| Molecular Weight | 407.72 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [(E)-4-(4-chlorophenyl)but-3-en-2-yl] (2E,4E)-5-(2,4-dichlorophenyl)penta-2,4-dienoate |
| SMILES | CC(/C=C/c1ccc(Cl)cc1)OC(=O)/C=C/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl3O2/c1-15(6-7-16-8-11-18(22)12-9-16)26-21(25)5-3-2-4-17-10-13-19(23)14-20(17)24/h2-15H,1H3/b4-2+,5-3+,7-6+ |
| InChIKey | QACNBJLZIYKQBM-UWORHUGCSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.72 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|