C27H29Cl2NO4 — CID 58952128
tert-butyl N-[(2E,4E)-5-(2-chloro-4-methoxyphenyl)penta-2,4-dienoyl]-N-[(Z,2R)-4-(4-chlorophenyl)but-3-en-2-yl]carbamate (PubChem CID 58952128) has the molecular formula C27H29Cl2NO4 and a molecular weight of 502.44 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E)-5-(2-chloro-4-methoxyphenyl)penta-2,4-dienoyl]-N-[(Z,2R)-4-(4-chlorophenyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E)-5-(2-chloro-4-methoxyphenyl)penta-2,4-dienoyl]-N-[(Z,2R)-4-(4-chlorophenyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58952128 |
| Molecular Formula | C27H29Cl2NO4 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | tert-butyl N-[(2E,4E)-5-(2-chloro-4-methoxyphenyl)penta-2,4-dienoyl]-N-[(Z,2R)-4-(4-chlorophenyl)but-3-en-2-yl]carbamate |
| SMILES | COc1ccc(/C=C/C=C/C(=O)N(C(=O)OC(C)(C)C)[C@H](C)/C=C\c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C27H29Cl2NO4/c1-19(10-11-20-12-15-22(28)16-13-20)30(26(32)34-27(2,3)4)25(31)9-7-6-8-21-14-17-23(33-5)18-24(21)29/h6-19H,1-5H3/b8-6+,9-7+,11-10-/t19-/m1/s1 |
| InChIKey | JPWLFPJXINRWBF-YUENXEDESA-N |
| XLogP | 7.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|