C15H10ClN3O2S — CID 873334
1-(3-chlorophenyl)-6-hydroxy-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 873334) has the molecular formula C15H10ClN3O2S and a molecular weight of 331.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-hydroxy-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3-chlorophenyl)-6-hydroxy-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 873334 |
| Molecular Formula | C15H10ClN3O2S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-(3-chlorophenyl)-6-hydroxy-5-(pyrrol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2cccc(Cl)c2)c(O)c1C=C1C=CC=N1 |
| InChI | InChI=1S/C15H10ClN3O2S/c16-9-3-1-5-11(7-9)19-14(21)12(13(20)18-15(19)22)8-10-4-2-6-17-10/h1-8,21H,(H,18,20,22) |
| InChIKey | WNFCILLJAUDHPZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|