C20H17F5N2O2S — CID 87333988
4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-5-ol (PubChem CID 87333988) has the molecular formula C20H17F5N2O2S and a molecular weight of 444.43 g/mol. Its IUPAC name is 4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-5-ol.
| Compound Name | 4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-5-ol |
|---|---|
| PubChem CID | 87333988 |
| Molecular Formula | C20H17F5N2O2S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 4-[4-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-5-ol |
| SMILES | Oc1ccc2scnc2c1N1CCC(Oc2cccc(C(F)(F)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H17F5N2O2S/c21-19(22,20(23,24)25)12-2-1-3-14(10-12)29-13-6-8-27(9-7-13)18-15(28)4-5-16-17(18)26-11-30-16/h1-5,10-11,13,28H,6-9H2 |
| InChIKey | OLBIWRSJOFFCTM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|