C15H27F3O2S — CID 87340891
ethyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate (PubChem CID 87340891) has the molecular formula C15H27F3O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is ethyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate.
| Compound Name | ethyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340891 |
| Molecular Formula | C15H27F3O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)SCCCCCCC(F)(F)F |
| InChI | InChI=1S/C15H27F3O2S/c1-4-20-14(19)13(11-12(2)3)21-10-8-6-5-7-9-15(16,17)18/h12-13H,4-11H2,1-3H3 |
| InChIKey | UMWOKDVWNREDGL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|