C13H24F2O2S — CID 87341013
2-(5,5-difluoroheptylsulfanyl)-3,3-dimethylbutanoic acid (PubChem CID 87341013) has the molecular formula C13H24F2O2S and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-(5,5-difluoroheptylsulfanyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(5,5-difluoroheptylsulfanyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87341013 |
| Molecular Formula | C13H24F2O2S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(5,5-difluoroheptylsulfanyl)-3,3-dimethylbutanoic acid |
| SMILES | CCC(F)(F)CCCCSC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H24F2O2S/c1-5-13(14,15)8-6-7-9-18-10(11(16)17)12(2,3)4/h10H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | QUYXFLAUTZIKPH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|