C25H21Cl2F5N2O3 — CID 87344689
(2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-3-(3-chloro-5-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 87344689) has the molecular formula C25H21Cl2F5N2O3 and a molecular weight of 563.35 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-3-(3-chloro-5-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-3-(3-chloro-5-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87344689 |
| Molecular Formula | C25H21Cl2F5N2O3 |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-3-(3-chloro-5-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)OC(=O)C(F)(F)F)[C@H](c2cc(F)cc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C25H21Cl2F5N2O3/c1-23(2,3)10-18-24(11-33,16-5-4-13(26)9-17(16)29)19(12-6-14(27)8-15(28)7-12)20(34-18)21(35)37-22(36)25(30,31)32/h4-9,18-20,34H,10H2,1-3H3/t18-,19-,20+,24-/m0/s1 |
| InChIKey | KSVPMZQIIKEFDP-KTIHBUSBSA-N |
| XLogP | 6.23 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|