C25H27N3O6 — CID 87346660
[(2S)-1-(1,3-benzoxazol-2-yl)-2-(morpholine-4-carbonyl)-1-oxo-6-phenylhexan-2-yl] carbamate (PubChem CID 87346660) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzoxazol-2-yl)-2-(morpholine-4-carbonyl)-1-oxo-6-phenylhexan-2-yl] carbamate.
| Compound Name | [(2S)-1-(1,3-benzoxazol-2-yl)-2-(morpholine-4-carbonyl)-1-oxo-6-phenylhexan-2-yl] carbamate |
|---|---|
| PubChem CID | 87346660 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [(2S)-1-(1,3-benzoxazol-2-yl)-2-(morpholine-4-carbonyl)-1-oxo-6-phenylhexan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@](CCCCc1ccccc1)(C(=O)c1nc2ccccc2o1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H27N3O6/c26-24(31)34-25(23(30)28-14-16-32-17-15-28,13-7-6-10-18-8-2-1-3-9-18)21(29)22-27-19-11-4-5-12-20(19)33-22/h1-5,8-9,11-12H,6-7,10,13-17H2,(H2,26,31)/t25-/m0/s1 |
| InChIKey | LFOWUNIZAMWMQJ-VWLOTQADSA-N |
| XLogP | 3.12 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|